CAS 188489-52-3 is the registry number for Methyl Flufenpyr. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.
Methyl 2-[2-chloro-4-fluoro-5-[5-methyl-6-oxo-4-(trifluoromethyl)pyridazin-1-yl]phenoxy]acetate (CAS 188489-52-3) is a chemical compound with the molecular formula C15H11ClF4N2O4 and a molecular weight of 394.70 g/mol. IUPAC name: methyl 2-[2-chloro-4-fluoro-5-[5-methyl-6-oxo-4-(trifluoromethyl)pyridazin-1-yl]phenoxy]acetate. InChIKey: UCXSELQUTMGPDK-UHFFFAOYSA-N.
| Molecular formula | C15H11ClF4N2O4 |
|---|---|
| Molecular weight | 394.70 g/mol |
| IUPAC name | methyl 2-[2-chloro-4-fluoro-5-[5-methyl-6-oxo-4-(trifluoromethyl)pyridazin-1-yl]phenoxy]acetate |
| InChIKey | UCXSELQUTMGPDK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NN(C1=O)C2=CC(=C(C=C2F)Cl)OCC(=O)OC)C(F)(F)F |
Computed by PubChem (NCBI)