CAS 18849-24-6 appears in our catalog under these names: Diphenyldi-o-tolylsilane, 95+%, Poly(2,5-dioctyl-1,4-phenylenevinylene). Offered by: Chemat Brand, Lumtec. Available pack sizes: on request.
Bis(2-methylphenyl)-diphenylsilane (CAS 18849-24-6) is a chemical compound with the molecular formula C26H24Si and a molecular weight of 364.6 g/mol. IUPAC name: bis(2-methylphenyl)-diphenylsilane. InChIKey: QJXVCEINEQQSPK-UHFFFAOYSA-N.
| Molecular formula | C26H24Si |
|---|---|
| Molecular weight | 364.6 g/mol |
| IUPAC name | bis(2-methylphenyl)-diphenylsilane |
| InChIKey | QJXVCEINEQQSPK-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1[Si](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4C |
Computed by PubChem (NCBI)