CAS 1885089-58-6 is the registry number for Dimethyl (1R,2S)-cyclopropane-1,2-dicarboxylate, 95%. Offered by: AmBeed. Available pack sizes: 100mg, 250mg.
Cis-dimethyl (1R,2S)-cyclopropane-1,2-dicarboxylate (CAS 1885089-58-6) is a chemical compound with the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. IUPAC name: cis-dimethyl (1R,2S)-cyclopropane-1,2-dicarboxylate. InChIKey: JBVOSZYUSFDYIN-SYDPRGILSA-N.
| Molecular formula | C7H10O4 |
|---|---|
| Molecular weight | 158.15 g/mol |
| IUPAC name | cis-dimethyl (1R,2S)-cyclopropane-1,2-dicarboxylate |
| InChIKey | JBVOSZYUSFDYIN-SYDPRGILSA-N |
| SMILES | COC(=O)[C@@H]1C[C@@H]1C(=O)OC |
Computed by PubChem (NCBI)