CAS 1885094-62-1 appears in our catalog under these names: Vonoprazan Impurity Y, Vonoprazan Fumarate Impurity 23, Vonoprazan Impurity 67, N,N-Dimethylmethanamine Vonoprazan, Vonoprazan Impurity 67 97%. Offered by: Chemat Brand, TRC, Biosynth, Ambeed, Chemat. Available pack sizes: on request, 100mg, 10mg, 50mg, 5g, 250mg, 1g, 25mg.
1-[5-(2-fluorophenyl)-1-pyridin-3-ylsulfonylpyrrol-3-yl]-N,N-dimethylmethanamine (CAS 1885094-62-1) is a chemical compound with the molecular formula C18H18FN3O2S and a molecular weight of 359.4 g/mol. IUPAC name: 1-[5-(2-fluorophenyl)-1-pyridin-3-ylsulfonylpyrrol-3-yl]-N,N-dimethylmethanamine. InChIKey: YUNMYHHGXTYDOY-UHFFFAOYSA-N.
| Molecular formula | C18H18FN3O2S |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | 1-[5-(2-fluorophenyl)-1-pyridin-3-ylsulfonylpyrrol-3-yl]-N,N-dimethylmethanamine |
| InChIKey | YUNMYHHGXTYDOY-UHFFFAOYSA-N |
| SMILES | CN(C)CC1=CN(C(=C1)C2=CC=CC=C2F)S(=O)(=O)C3=CN=CC=C3 |
Computed by PubChem (NCBI)