CAS 188647-25-8 is the registry number for 1–Ethenyl–4–(tris(4–ethenylphenyl)methyl)benzene. Offered by: GLPBio. Available pack sizes: 1g.
1-ethenyl-4-[tris(4-ethenylphenyl)methyl]benzene (CAS 188647-25-8) is a chemical compound with the molecular formula C33H28 and a molecular weight of 424.6 g/mol. IUPAC name: 1-ethenyl-4-[tris(4-ethenylphenyl)methyl]benzene. InChIKey: PSGMDUASGFGGHR-UHFFFAOYSA-N.
| Molecular formula | C33H28 |
|---|---|
| Molecular weight | 424.6 g/mol |
| IUPAC name | 1-ethenyl-4-[tris(4-ethenylphenyl)methyl]benzene |
| InChIKey | PSGMDUASGFGGHR-UHFFFAOYSA-N |
| SMILES | C=CC1=CC=C(C=C1)C(C2=CC=C(C=C2)C=C)(C3=CC=C(C=C3)C=C)C4=CC=C(C=C4)C=C |
Computed by PubChem (NCBI)