CAS 188649-48-1 appears in our catalog under these names: Clevidipine butyrate impurity iv, 95%, Clevidipine Impurity 5, Clevidipine Impurity D, 4-(2,3-Dichlorophenyl)-2,6-dimethyl-3,5-pyridinedicarboxylic Acid Methyl (1-oxobutoxy)methyl Ester, Dehydro Clevidipine. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
3-O-(butanoyloxymethyl) 5-O-methyl 4-(2,3-dichlorophenyl)-2,6-dimethylpyridine-3,5-dicarboxylate (CAS 188649-48-1) is a chemical compound with the molecular formula C21H21Cl2NO6 and a molecular weight of 454.3 g/mol. IUPAC name: 3-O-(butanoyloxymethyl) 5-O-methyl 4-(2,3-dichlorophenyl)-2,6-dimethylpyridine-3,5-dicarboxylate. InChIKey: GFSJHJKKEVHZBW-UHFFFAOYSA-N.
| Molecular formula | C21H21Cl2NO6 |
|---|---|
| Molecular weight | 454.3 g/mol |
| IUPAC name | 3-O-(butanoyloxymethyl) 5-O-methyl 4-(2,3-dichlorophenyl)-2,6-dimethylpyridine-3,5-dicarboxylate |
| InChIKey | GFSJHJKKEVHZBW-UHFFFAOYSA-N |
| SMILES | CCCC(=O)OCOC(=O)C1=C(C(=C(N=C1C)C)C(=O)OC)C2=C(C(=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)