CAS 1886967-57-2 appears in our catalog under these names: 3-(tert-Butyl)bicyclo(1.1.1)pentan-1-amine hydrochloride, 95%, 3-tert-Butylbicyclo(1.1.1)pentan-1-amine hydrochloride, 3-tert-butylbicyclo[1.1.1]pentan-1-amine hydrochloride, 95%, 95%, 3-(tert-Butyl)bicyclo[1.1.1]pentan-1-amine hydrochloride, 95%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 0,5g, 50mg, 100mg, 250mg, 500mg, 1g.
3-tert-butylbicyclo[1.1.1]pentan-1-amine;hydrochloride (CAS 1886967-57-2) is a chemical compound with the molecular formula C9H18ClN and a molecular weight of 175.70 g/mol. IUPAC name: 3-tert-butylbicyclo[1.1.1]pentan-1-amine;hydrochloride. InChIKey: LTLYJLCRQVVFBS-UHFFFAOYSA-N.
| Molecular formula | C9H18ClN |
|---|---|
| Molecular weight | 175.70 g/mol |
| IUPAC name | 3-tert-butylbicyclo[1.1.1]pentan-1-amine;hydrochloride |
| InChIKey | LTLYJLCRQVVFBS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C12CC(C1)(C2)N.Cl |
Computed by PubChem (NCBI)