CAS 1886967-65-2 is the registry number for 2-(3-(Trifluoromethyl)bicyclo(1.1.1)pentan-1-yl)acetic acid, 98%. Offered by: AmBeed. Available pack sizes: 250mg.
2-[3-(trifluoromethyl)-1-bicyclo[1.1.1]pentanyl]acetic acid (CAS 1886967-65-2) is a chemical compound with the molecular formula C8H9F3O2 and a molecular weight of 194.15 g/mol. IUPAC name: 2-[3-(trifluoromethyl)-1-bicyclo[1.1.1]pentanyl]acetic acid. InChIKey: GZENETPOWWTEMZ-UHFFFAOYSA-N.
| Molecular formula | C8H9F3O2 |
|---|---|
| Molecular weight | 194.15 g/mol |
| IUPAC name | 2-[3-(trifluoromethyl)-1-bicyclo[1.1.1]pentanyl]acetic acid |
| InChIKey | GZENETPOWWTEMZ-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(C2)C(F)(F)F)CC(=O)O |
Computed by PubChem (NCBI)