CAS 1887-29-2 appears in our catalog under these names: Benzenethionsulfonic acid,sodium salt, tech grade, 90%, BENZENETHIONOSULFONIC ACID, SODIUM SALT, Sodium benzenesulfonothioate 97%, BENZENETHIONOSULFONIC ACID, SODIUM SALT,, Sodium thiobenzosulfonate, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 5g, 100g, 25g, 10g, 1g, 100mg, 250mg, 50g.
Sodium oxido-oxo-phenyl-sulfanylidene-lambda6-sulfane (CAS 1887-29-2) is a chemical compound with the molecular formula C6H5NaO2S2 and a molecular weight of 196.2 g/mol. IUPAC name: sodium oxido-oxo-phenyl-sulfanylidene-lambda6-sulfane. InChIKey: BZHOWMPPNDKQSQ-UHFFFAOYSA-M.
| Molecular formula | C6H5NaO2S2 |
|---|---|
| Molecular weight | 196.2 g/mol |
| IUPAC name | sodium oxido-oxo-phenyl-sulfanylidene-lambda6-sulfane |
| InChIKey | BZHOWMPPNDKQSQ-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)S(=O)(=S)[O-].[Na+] |
Computed by PubChem (NCBI)