CAS 1887014-13-2 is the registry number for N-Desmethyl Olutasidenib. Offered by: TRC. Available pack sizes: 25mg, 5mg.
5-[[(1S)-1-(6-chloro-2-oxo-1H-quinolin-3-yl)ethyl]amino]-6-oxo-1H-pyridine-2-carbonitrile (CAS 1887014-13-2) is a chemical compound with the molecular formula C17H13ClN4O2 and a molecular weight of 340.8 g/mol. IUPAC name: 5-[[(1S)-1-(6-chloro-2-oxo-1H-quinolin-3-yl)ethyl]amino]-6-oxo-1H-pyridine-2-carbonitrile. InChIKey: UXVGPOVENBADCI-VIFPVBQESA-N.
| Molecular formula | C17H13ClN4O2 |
|---|---|
| Molecular weight | 340.8 g/mol |
| IUPAC name | 5-[[(1S)-1-(6-chloro-2-oxo-1H-quinolin-3-yl)ethyl]amino]-6-oxo-1H-pyridine-2-carbonitrile |
| InChIKey | UXVGPOVENBADCI-VIFPVBQESA-N |
| SMILES | C[C@@H](C1=CC2=C(C=CC(=C2)Cl)NC1=O)NC3=CC=C(NC3=O)C#N |
Computed by PubChem (NCBI)