CAS 1887792-58-6 is the registry number for Diethyl 2-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl)malonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Diethyl 2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]propanedioate (CAS 1887792-58-6) is a chemical compound with the molecular formula C20H29BO6 and a molecular weight of 376.3 g/mol. IUPAC name: diethyl 2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]propanedioate. InChIKey: WIAPOCZBXBWTJT-UHFFFAOYSA-N.
| Molecular formula | C20H29BO6 |
|---|---|
| Molecular weight | 376.3 g/mol |
| IUPAC name | diethyl 2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]propanedioate |
| InChIKey | WIAPOCZBXBWTJT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CC(C(=O)OCC)C(=O)OCC |
Computed by PubChem (NCBI)