CAS 188797-77-5 appears in our catalog under these names: Ziprasidone Impurity 11, Ziprasidone Impurity 16. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-5-[2-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-1,3-dihydroindol-2-one (CAS 188797-77-5) is a chemical compound with the molecular formula C21H21ClN4O3S and a molecular weight of 444.9 g/mol. IUPAC name: 6-chloro-5-[2-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-1,3-dihydroindol-2-one. InChIKey: ZVNYBRYFGRKHFN-UHFFFAOYSA-N.
| Molecular formula | C21H21ClN4O3S |
|---|---|
| Molecular weight | 444.9 g/mol |
| IUPAC name | 6-chloro-5-[2-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-1,3-dihydroindol-2-one |
| InChIKey | ZVNYBRYFGRKHFN-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CCC2=C(C=C3C(=C2)CC(=O)N3)Cl)C4=NS(=O)(=O)C5=CC=CC=C54 |
Computed by PubChem (NCBI)