CAS 188826-61-1 appears in our catalog under these names: N–(3–(Dimethylamino)allylidene)–N–methylmethanaminium Hexafluorophosphate, N-[3-(Dimethylamino)allylidene]-N-methylmethanaminium Hexafluorophosphate, 98%, 98%, N-[3-(Dimethylamino)allylidene]-N-methylmethanaminium Hexafluorophosphate, 98%, Etoricoxib Impurity 62. Offered by: GLPBio, Chemat, Fluorochem, Ambeed, Chemat Brand. Available pack sizes: 1g, 5g, 250mg, 10g, 25g, on request.
[(E)-3-(dimethylamino)prop-2-enylidene]-dimethylazanium hexafluorophosphate (CAS 188826-61-1) is a chemical compound with the molecular formula C7H15F6N2P and a molecular weight of 272.17 g/mol. IUPAC name: [(E)-3-(dimethylamino)prop-2-enylidene]-dimethylazanium hexafluorophosphate. InChIKey: OXNPJRWNJQGZRQ-UHFFFAOYSA-N.
| Molecular formula | C7H15F6N2P |
|---|---|
| Molecular weight | 272.17 g/mol |
| IUPAC name | [(E)-3-(dimethylamino)prop-2-enylidene]-dimethylazanium hexafluorophosphate |
| InChIKey | OXNPJRWNJQGZRQ-UHFFFAOYSA-N |
| SMILES | CN(C)/C=C/C=[N+](C)C.F[P-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)