Products 188837-53-8

CAS 188837-53-8 is the registry number for Pentafluorophenyl pyridine-2-carboxylate, 95% . Offered by: Thermo Scientific. Available pack sizes: 250MG, 1g.

Structural formula: {0} (CAS {1})

(2,3,4,5,6-pentafluorophenyl) pyridine-2-carboxylate (CAS 188837-53-8) is a chemical compound with the molecular formula C12H4F5NO2 and a molecular weight of 289.16 g/mol. IUPAC name: (2,3,4,5,6-pentafluorophenyl) pyridine-2-carboxylate. InChIKey: KFJSLIBBYMXLTG-UHFFFAOYSA-N.

Identity
Molecular formulaC12H4F5NO2
Molecular weight289.16 g/mol
IUPAC name(2,3,4,5,6-pentafluorophenyl) pyridine-2-carboxylate
InChIKeyKFJSLIBBYMXLTG-UHFFFAOYSA-N
SMILESC1=CC=NC(=C1)C(=O)OC2=C(C(=C(C(=C2F)F)F)F)F

Computed by PubChem (NCBI)