CAS 188837-53-8 is the registry number for Pentafluorophenyl pyridine-2-carboxylate, 95% . Offered by: Thermo Scientific. Available pack sizes: 250MG, 1g.
(2,3,4,5,6-pentafluorophenyl) pyridine-2-carboxylate (CAS 188837-53-8) is a chemical compound with the molecular formula C12H4F5NO2 and a molecular weight of 289.16 g/mol. IUPAC name: (2,3,4,5,6-pentafluorophenyl) pyridine-2-carboxylate. InChIKey: KFJSLIBBYMXLTG-UHFFFAOYSA-N.
| Molecular formula | C12H4F5NO2 |
|---|---|
| Molecular weight | 289.16 g/mol |
| IUPAC name | (2,3,4,5,6-pentafluorophenyl) pyridine-2-carboxylate |
| InChIKey | KFJSLIBBYMXLTG-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C(=O)OC2=C(C(=C(C(=C2F)F)F)F)F |
Computed by PubChem (NCBI)