CAS 1888398-19-3 is the registry number for (7-Cyano-9,9-dimethyl-9H-fluoren-2-yl)boronic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(7-cyano-9,9-dimethylfluoren-2-yl)boronic acid (CAS 1888398-19-3) is a chemical compound with the molecular formula C16H14BNO2 and a molecular weight of 263.1 g/mol. IUPAC name: (7-cyano-9,9-dimethylfluoren-2-yl)boronic acid. InChIKey: HLWWLLJALLDDFU-UHFFFAOYSA-N.
| Molecular formula | C16H14BNO2 |
|---|---|
| Molecular weight | 263.1 g/mol |
| IUPAC name | (7-cyano-9,9-dimethylfluoren-2-yl)boronic acid |
| InChIKey | HLWWLLJALLDDFU-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C3=C(C2(C)C)C=C(C=C3)C#N)(O)O |
Computed by PubChem (NCBI)