Products 1888398-19-3

CAS 1888398-19-3 is the registry number for (7-Cyano-9,9-dimethyl-9H-fluoren-2-yl)boronic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

(7-cyano-9,9-dimethylfluoren-2-yl)boronic acid (CAS 1888398-19-3) is a chemical compound with the molecular formula C16H14BNO2 and a molecular weight of 263.1 g/mol. IUPAC name: (7-cyano-9,9-dimethylfluoren-2-yl)boronic acid. InChIKey: HLWWLLJALLDDFU-UHFFFAOYSA-N.

Identity
Molecular formulaC16H14BNO2
Molecular weight263.1 g/mol
IUPAC name(7-cyano-9,9-dimethylfluoren-2-yl)boronic acid
InChIKeyHLWWLLJALLDDFU-UHFFFAOYSA-N
SMILESB(C1=CC2=C(C=C1)C3=C(C2(C)C)C=C(C=C3)C#N)(O)O

Computed by PubChem (NCBI)