Products 188844-34-0
CAS 188844-34-0 appears in our catalog under these names: HX 531, >95% (HPLC), HX 531/ 99.43% (existing batch purity), HX 531, HX 531, HX531 99%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 1mg, 2,5mg, 5mg, 10mg, 25mg, 50mg, 100mg, 25 mg.
4-(5,7,7,10,10-pentamethyl-2-nitro-8,9-dihydronaphtho[2,3-b][1,5]benzodiazepin-12-yl)benzoic acid (CAS 188844-34-0) is a chemical compound with the molecular formula C29H29N3O4 and a molecular weight of 483.6 g/mol. IUPAC name: 4-(5,7,7,10,10-pentamethyl-2-nitro-8,9-dihydronaphtho[2,3-b][1,5]benzodiazepin-12-yl)benzoic acid. InChIKey: SXKPGYKPQPYJER-UHFFFAOYSA-N.
| Molecular formula | C29H29N3O4 |
|---|---|
| Molecular weight | 483.6 g/mol |
| IUPAC name | 4-(5,7,7,10,10-pentamethyl-2-nitro-8,9-dihydronaphtho[2,3-b][1,5]benzodiazepin-12-yl)benzoic acid |
| InChIKey | SXKPGYKPQPYJER-UHFFFAOYSA-N |
| SMILES | CC1(CCC(C2=C1C=C3C(=C2)N(C4=C(C=C(C=C4)[N+](=O)[O-])N=C3C5=CC=C(C=C5)C(=O)O)C)(C)C)C |
Computed by PubChem (NCBI)