CAS 188844-52-2 appears in our catalog under these names: HX 630, HX 630, HX630. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 500mg, 10mg, 5mg, 25mg, Get quote.
4-(7,7,10,10-tetramethyl-8,9-dihydronaphtho[2,3-b][1,5]benzothiazepin-12-yl)benzoic acid (CAS 188844-52-2) is a chemical compound with the molecular formula C28H27NO2S and a molecular weight of 441.6 g/mol. IUPAC name: 4-(7,7,10,10-tetramethyl-8,9-dihydronaphtho[2,3-b][1,5]benzothiazepin-12-yl)benzoic acid. InChIKey: PFGCWQPTOKPRRK-UHFFFAOYSA-N.
| Molecular formula | C28H27NO2S |
|---|---|
| Molecular weight | 441.6 g/mol |
| IUPAC name | 4-(7,7,10,10-tetramethyl-8,9-dihydronaphtho[2,3-b][1,5]benzothiazepin-12-yl)benzoic acid |
| InChIKey | PFGCWQPTOKPRRK-UHFFFAOYSA-N |
| SMILES | CC1(CCC(C2=C1C=C3C(=C2)SC4=CC=CC=C4N=C3C5=CC=C(C=C5)C(=O)O)(C)C)C |
Computed by PubChem (NCBI)