CAS 1888441-48-2 is the registry number for (3-(1H-1,2,4-Triazol-1-yl)phenyl)boronic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[3-(1,2,4-triazol-1-yl)phenyl]boronic acid (CAS 1888441-48-2) is a chemical compound with the molecular formula C8H8BN3O2 and a molecular weight of 188.98 g/mol. IUPAC name: [3-(1,2,4-triazol-1-yl)phenyl]boronic acid. InChIKey: NRQRWSPOZLIPSA-UHFFFAOYSA-N.
| Molecular formula | C8H8BN3O2 |
|---|---|
| Molecular weight | 188.98 g/mol |
| IUPAC name | [3-(1,2,4-triazol-1-yl)phenyl]boronic acid |
| InChIKey | NRQRWSPOZLIPSA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)N2C=NC=N2)(O)O |
Computed by PubChem (NCBI)