CAS 188918-44-7 is the registry number for tert-Butyl ((1R,3S)-3-acetyl-2,2-dimethylcyclobutyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(1R,3S)-3-acetyl-2,2-dimethylcyclobutyl]carbamate (CAS 188918-44-7) is a chemical compound with the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. IUPAC name: tert-butyl N-[(1R,3S)-3-acetyl-2,2-dimethylcyclobutyl]carbamate. InChIKey: ZFPHIYJPTMJYMI-NXEZZACHSA-N.
| Molecular formula | C13H23NO3 |
|---|---|
| Molecular weight | 241.33 g/mol |
| IUPAC name | tert-butyl N-[(1R,3S)-3-acetyl-2,2-dimethylcyclobutyl]carbamate |
| InChIKey | ZFPHIYJPTMJYMI-NXEZZACHSA-N |
| SMILES | CC(=O)[C@H]1C[C@H](C1(C)C)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)