CAS 1889289-70-6 is the registry number for methyl (2R)-2-(tert-butoxycarbonylamino)-2-(oxetan-3-yl)acetate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(oxetan-3-yl)acetate (CAS 1889289-70-6) is a chemical compound with the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. IUPAC name: methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(oxetan-3-yl)acetate. InChIKey: AEEKGWYJXBGAMG-MRVPVSSYSA-N.
| Molecular formula | C11H19NO5 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(oxetan-3-yl)acetate |
| InChIKey | AEEKGWYJXBGAMG-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](C1COC1)C(=O)OC |
Computed by PubChem (NCBI)