Products 1889667-88-2

CAS 1889667-88-2 is the registry number for 3-(Difluoromethyl)-4,4-dimethylpentanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-(difluoromethyl)-4,4-dimethylpentanoic acid (CAS 1889667-88-2) is a chemical compound with the molecular formula C8H14F2O2 and a molecular weight of 180.19 g/mol. IUPAC name: 3-(difluoromethyl)-4,4-dimethylpentanoic acid. InChIKey: JWZUHPNTBNQLSW-UHFFFAOYSA-N.

Identity
Molecular formulaC8H14F2O2
Molecular weight180.19 g/mol
IUPAC name3-(difluoromethyl)-4,4-dimethylpentanoic acid
InChIKeyJWZUHPNTBNQLSW-UHFFFAOYSA-N
SMILESCC(C)(C)C(CC(=O)O)C(F)F

Computed by PubChem (NCBI)