CAS 18897-36-4 is the registry number for Cadmium pyrithione. Offered by: MedChemExpress. Available pack sizes: Get quote.
Cadmium(2+);bis(1-oxidopyridine-2-thione) (CAS 18897-36-4) is a chemical compound with the molecular formula C10H8CdN2O2S2 and a molecular weight of 364.7 g/mol. IUPAC name: cadmium(2+);bis(1-oxidopyridine-2-thione). InChIKey: YSWAWAYOPDDQJN-UHFFFAOYSA-N.
| Molecular formula | C10H8CdN2O2S2 |
|---|---|
| Molecular weight | 364.7 g/mol |
| IUPAC name | cadmium(2+);bis(1-oxidopyridine-2-thione) |
| InChIKey | YSWAWAYOPDDQJN-UHFFFAOYSA-N |
| SMILES | C1=CC(=S)N(C=C1)[O-].C1=CC(=S)N(C=C1)[O-].[Cd+2] |
Computed by PubChem (NCBI)