Products 1890002-03-5
CAS 1890002-03-5 is the registry number for 7-Mercapto-2H-benzo[b][1,4]thiazin-3(4H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-sulfanyl-4H-1,4-benzothiazin-3-one (CAS 1890002-03-5) is a chemical compound with the molecular formula C8H7NOS2 and a molecular weight of 197.3 g/mol. IUPAC name: 7-sulfanyl-4H-1,4-benzothiazin-3-one. InChIKey: GZGLGHZXOQXMDX-UHFFFAOYSA-N.
| Molecular formula | C8H7NOS2 |
|---|---|
| Molecular weight | 197.3 g/mol |
| IUPAC name | 7-sulfanyl-4H-1,4-benzothiazin-3-one |
| InChIKey | GZGLGHZXOQXMDX-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(S1)C=C(C=C2)S |
Computed by PubChem (NCBI)