Products 18904-53-5
CAS 18904-53-5 appears in our catalog under these names: Z-Val-trp-oh, 98%, Cbz-Val-Trp-OH 98%, ((Benzyloxy)carbonyl)-L-valyl-L-tryptophan, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 25g, 5g, 1g.
(2S)-3-(1H-indol-3-yl)-2-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]propanoic acid (CAS 18904-53-5) is a chemical compound with the molecular formula C24H27N3O5 and a molecular weight of 437.5 g/mol. IUPAC name: (2S)-3-(1H-indol-3-yl)-2-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]propanoic acid. InChIKey: OFRAUBNHWUYJIM-SFTDATJTSA-N.
| Molecular formula | C24H27N3O5 |
|---|---|
| Molecular weight | 437.5 g/mol |
| IUPAC name | (2S)-3-(1H-indol-3-yl)-2-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]propanoic acid |
| InChIKey | OFRAUBNHWUYJIM-SFTDATJTSA-N |
| SMILES | CC(C)[C@@H](C(=O)N[C@@H](CC1=CNC2=CC=CC=C21)C(=O)O)NC(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)