CAS 18905-74-3 appears in our catalog under these names: L-Lysine beta-naphthylamide carbonate, 95%, (S)-2,6-Diamino-N-(naphthalen-2-yl)hexanamide carbonate, 95+%, H–Lys–βNA. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 5g, 250mg.
Carbonic acid;(2S)-2,6-diamino-N-naphthalen-2-ylhexanamide (CAS 18905-74-3) is a chemical compound with the molecular formula C17H23N3O4 and a molecular weight of 333.4 g/mol. IUPAC name: carbonic acid;(2S)-2,6-diamino-N-naphthalen-2-ylhexanamide. InChIKey: YEAQTLIHEPYBCP-RSAXXLAASA-N.
| Molecular formula | C17H23N3O4 |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | carbonic acid;(2S)-2,6-diamino-N-naphthalen-2-ylhexanamide |
| InChIKey | YEAQTLIHEPYBCP-RSAXXLAASA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)NC(=O)[C@H](CCCCN)N.C(=O)(O)O |
Computed by PubChem (NCBI)