CAS 189057-68-9 is the registry number for ZINC05626394, 99.8%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 1 mg.
6-(phenylsulfanylmethyl)-2-sulfanylidene-1H-pyrimidin-4-one (CAS 189057-68-9) is a chemical compound with the molecular formula C11H10N2OS2 and a molecular weight of 250.3 g/mol. IUPAC name: 6-(phenylsulfanylmethyl)-2-sulfanylidene-1H-pyrimidin-4-one. InChIKey: VNTBGGWDZYETPH-UHFFFAOYSA-N.
| Molecular formula | C11H10N2OS2 |
|---|---|
| Molecular weight | 250.3 g/mol |
| IUPAC name | 6-(phenylsulfanylmethyl)-2-sulfanylidene-1H-pyrimidin-4-one |
| InChIKey | VNTBGGWDZYETPH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)SCC2=CC(=O)NC(=S)N2 |
Computed by PubChem (NCBI)