Products 18908-38-8
CAS 18908-38-8 is the registry number for (3aR,6aR)-2,2-Dimethyltetrahydro-4H-[1,3]dioxolo[4,5-c]pyrrol-4-one, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(3aR,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-one (CAS 18908-38-8) is a chemical compound with the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. IUPAC name: (3aR,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-one. InChIKey: AKOYRYRJZZSFBU-RFZPGFLSSA-N.
| Molecular formula | C7H11NO3 |
|---|---|
| Molecular weight | 157.17 g/mol |
| IUPAC name | (3aR,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-one |
| InChIKey | AKOYRYRJZZSFBU-RFZPGFLSSA-N |
| SMILES | CC1(O[C@@H]2CNC(=O)[C@@H]2O1)C |
Computed by PubChem (NCBI)