CAS 4576-30-1 is the registry number for Diexo-3-amino-7-oxa-bicyclo[2.2.1]heptane-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
(1R,2S,3R,4S)-3-amino-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid (CAS 4576-30-1) is a chemical compound with the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. IUPAC name: (1R,2S,3R,4S)-3-amino-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid. InChIKey: IBJRDBSWQMNJKY-MOJAZDJTSA-N.
| Molecular formula | C7H11NO3 |
|---|---|
| Molecular weight | 157.17 g/mol |
| IUPAC name | (1R,2S,3R,4S)-3-amino-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid |
| InChIKey | IBJRDBSWQMNJKY-MOJAZDJTSA-N |
| SMILES | C1C[C@H]2[C@@H]([C@@H]([C@@H]1O2)C(=O)O)N |
Computed by PubChem (NCBI)