Products 4576-30-1

CAS 4576-30-1 is the registry number for Diexo-3-amino-7-oxa-bicyclo[2.2.1]heptane-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

(1R,2S,3R,4S)-3-amino-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid (CAS 4576-30-1) is a chemical compound with the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. IUPAC name: (1R,2S,3R,4S)-3-amino-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid. InChIKey: IBJRDBSWQMNJKY-MOJAZDJTSA-N.

Identity
Molecular formulaC7H11NO3
Molecular weight157.17 g/mol
IUPAC name(1R,2S,3R,4S)-3-amino-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid
InChIKeyIBJRDBSWQMNJKY-MOJAZDJTSA-N
SMILESC1C[C@H]2[C@@H]([C@@H]([C@@H]1O2)C(=O)O)N

Computed by PubChem (NCBI)