CAS 1891926-61-6 is the registry number for ethyl 2-(3,5-dichloro-4-fluorophenyl)-2-oxoacetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
Ethyl 2-(3,5-dichloro-4-fluorophenyl)-2-oxoacetate (CAS 1891926-61-6) is a chemical compound with the molecular formula C10H7Cl2FO3 and a molecular weight of 265.06 g/mol. IUPAC name: ethyl 2-(3,5-dichloro-4-fluorophenyl)-2-oxoacetate. InChIKey: DAZSCUISQIZKLX-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2FO3 |
|---|---|
| Molecular weight | 265.06 g/mol |
| IUPAC name | ethyl 2-(3,5-dichloro-4-fluorophenyl)-2-oxoacetate |
| InChIKey | DAZSCUISQIZKLX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)C1=CC(=C(C(=C1)Cl)F)Cl |
Computed by PubChem (NCBI)