CAS 1892-03-1 is the registry number for 1H-Heptafluorocyclopentene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
1,3,3,4,4,5,5-heptafluorocyclopentene (CAS 1892-03-1) is a chemical compound with the molecular formula C5HF7 and a molecular weight of 194.05 g/mol. IUPAC name: 1,3,3,4,4,5,5-heptafluorocyclopentene. InChIKey: AWDCOETZVBNIIV-UHFFFAOYSA-N.
| Molecular formula | C5HF7 |
|---|---|
| Molecular weight | 194.05 g/mol |
| IUPAC name | 1,3,3,4,4,5,5-heptafluorocyclopentene |
| InChIKey | AWDCOETZVBNIIV-UHFFFAOYSA-N |
| SMILES | C1=C(C(C(C1(F)F)(F)F)(F)F)F |
Computed by PubChem (NCBI)