Products 1892137-78-8

CAS 1892137-78-8 is the registry number for 2-(6-Bromobenzo[d][1,3]dioxol-5-yl)-2-hydroxyacetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(6-bromo-1,3-benzodioxol-5-yl)-2-hydroxyacetic acid (CAS 1892137-78-8) is a chemical compound with the molecular formula C9H7BrO5 and a molecular weight of 275.05 g/mol. IUPAC name: 2-(6-bromo-1,3-benzodioxol-5-yl)-2-hydroxyacetic acid. InChIKey: ZOXFPAGNAKGFOY-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7BrO5
Molecular weight275.05 g/mol
IUPAC name2-(6-bromo-1,3-benzodioxol-5-yl)-2-hydroxyacetic acid
InChIKeyZOXFPAGNAKGFOY-UHFFFAOYSA-N
SMILESC1OC2=C(O1)C=C(C(=C2)C(C(=O)O)O)Br

Computed by PubChem (NCBI)