CAS 1892137-78-8 is the registry number for 2-(6-Bromobenzo[d][1,3]dioxol-5-yl)-2-hydroxyacetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(6-bromo-1,3-benzodioxol-5-yl)-2-hydroxyacetic acid (CAS 1892137-78-8) is a chemical compound with the molecular formula C9H7BrO5 and a molecular weight of 275.05 g/mol. IUPAC name: 2-(6-bromo-1,3-benzodioxol-5-yl)-2-hydroxyacetic acid. InChIKey: ZOXFPAGNAKGFOY-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO5 |
|---|---|
| Molecular weight | 275.05 g/mol |
| IUPAC name | 2-(6-bromo-1,3-benzodioxol-5-yl)-2-hydroxyacetic acid |
| InChIKey | ZOXFPAGNAKGFOY-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)C(C(=O)O)O)Br |
Computed by PubChem (NCBI)