Products 1892415-56-3

CAS 1892415-56-3 is the registry number for 5-Cyclopropylthiazole-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-cyclopropyl-1,3-thiazole-2-carboxylic acid (CAS 1892415-56-3) is a chemical compound with the molecular formula C7H7NO2S and a molecular weight of 169.20 g/mol. IUPAC name: 5-cyclopropyl-1,3-thiazole-2-carboxylic acid. InChIKey: WJGYSEIYBUGBJB-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7NO2S
Molecular weight169.20 g/mol
IUPAC name5-cyclopropyl-1,3-thiazole-2-carboxylic acid
InChIKeyWJGYSEIYBUGBJB-UHFFFAOYSA-N
SMILESC1CC1C2=CN=C(S2)C(=O)O

Computed by PubChem (NCBI)