Products 1892434-66-0
CAS 1892434-66-0 is the registry number for 2-Fluoro-α,α-dimethyl-5-(methylthio)benzenemethanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-(2-fluoro-5-methylsulfanylphenyl)propan-2-ol (CAS 1892434-66-0) is a chemical compound with the molecular formula C10H13FOS and a molecular weight of 200.27 g/mol. IUPAC name: 2-(2-fluoro-5-methylsulfanylphenyl)propan-2-ol. InChIKey: KWNBHRZZOWWBPA-UHFFFAOYSA-N.
| Molecular formula | C10H13FOS |
|---|---|
| Molecular weight | 200.27 g/mol |
| IUPAC name | 2-(2-fluoro-5-methylsulfanylphenyl)propan-2-ol |
| InChIKey | KWNBHRZZOWWBPA-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=C(C=CC(=C1)SC)F)O |
Computed by PubChem (NCBI)