CAS 189279-58-1 appears in our catalog under these names: Delafloxacin, Delafloxacin, >95% (HPLC), Delafloxacin/ 99.81% (existing batch purity), Delafloxacin - Bio-X â„¢, Delafloxacin, >98.0%(HPLC)(T). Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, TargetMol, GLPBio. Available pack sizes: on request, 10mg, 50mg, 5mg, 25mg, 100mg, 200mg, 500mg.
1-(6-amino-3,5-difluoro-2-pyridinyl)-8-chloro-6-fluoro-7-(3-hydroxyazetidin-1-yl)-4-oxoquinoline-3-carboxylic acid (CAS 189279-58-1) is a chemical compound with the molecular formula C18H12ClF3N4O4 and a molecular weight of 440.8 g/mol. IUPAC name: 1-(6-amino-3,5-difluoro-2-pyridinyl)-8-chloro-6-fluoro-7-(3-hydroxyazetidin-1-yl)-4-oxoquinoline-3-carboxylic acid. InChIKey: DYDCPNMLZGFQTM-UHFFFAOYSA-N.
| Molecular formula | C18H12ClF3N4O4 |
|---|---|
| Molecular weight | 440.8 g/mol |
| IUPAC name | 1-(6-amino-3,5-difluoro-2-pyridinyl)-8-chloro-6-fluoro-7-(3-hydroxyazetidin-1-yl)-4-oxoquinoline-3-carboxylic acid |
| InChIKey | DYDCPNMLZGFQTM-UHFFFAOYSA-N |
| SMILES | C1C(CN1C2=C(C=C3C(=C2Cl)N(C=C(C3=O)C(=O)O)C4=C(C=C(C(=N4)N)F)F)F)O |
Computed by PubChem (NCBI)