CAS 18929-75-4 is the registry number for (2R,3R,4S,5S,6R)-2-Methoxy-6-methyltetrahydro-2H-pyran-3,4,5-triyl tribenzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3S,4S,5R,6R)-4,5-dibenzoyloxy-6-methoxy-2-methyloxan-3-yl] benzoate (CAS 18929-75-4) is a chemical compound with the molecular formula C28H26O8 and a molecular weight of 490.5 g/mol. IUPAC name: [(2R,3S,4S,5R,6R)-4,5-dibenzoyloxy-6-methoxy-2-methyloxan-3-yl] benzoate. InChIKey: QMEUMOLROUFAFX-GXACUTFZSA-N.
| Molecular formula | C28H26O8 |
|---|---|
| Molecular weight | 490.5 g/mol |
| IUPAC name | [(2R,3S,4S,5R,6R)-4,5-dibenzoyloxy-6-methoxy-2-methyloxan-3-yl] benzoate |
| InChIKey | QMEUMOLROUFAFX-GXACUTFZSA-N |
| SMILES | C[C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)OC)OC(=O)C2=CC=CC=C2)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)