CAS 189290-58-2 appears in our catalog under these names: 4-Quinazolinamine, n-(3-iodophenyl)-6,7-dimethoxy-, 95%, AG1557/ 99.15% (existing batch purity), AG–1557, AG-1557, AG1557, 99.54%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1g, 250mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
N-(3-iodophenyl)-6,7-dimethoxyquinazolin-4-amine (CAS 189290-58-2) is a chemical compound with the molecular formula C16H14IN3O2 and a molecular weight of 407.21 g/mol. IUPAC name: N-(3-iodophenyl)-6,7-dimethoxyquinazolin-4-amine. InChIKey: FGCLAQLIXMAIHT-UHFFFAOYSA-N.
| Molecular formula | C16H14IN3O2 |
|---|---|
| Molecular weight | 407.21 g/mol |
| IUPAC name | N-(3-iodophenyl)-6,7-dimethoxyquinazolin-4-amine |
| InChIKey | FGCLAQLIXMAIHT-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC(=CC=C3)I)OC |
Computed by PubChem (NCBI)