Products 1893028-75-5
CAS 1893028-75-5 is the registry number for (4-Bromo-2,3,5-trifluorophenyl)methanamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4-bromo-2,3,5-trifluorophenyl)methanamine (CAS 1893028-75-5) is a chemical compound with the molecular formula C7H5BrF3N and a molecular weight of 240.02 g/mol. IUPAC name: (4-bromo-2,3,5-trifluorophenyl)methanamine. InChIKey: KKTJLZPQCBGJQQ-UHFFFAOYSA-N.
| Molecular formula | C7H5BrF3N |
|---|---|
| Molecular weight | 240.02 g/mol |
| IUPAC name | (4-bromo-2,3,5-trifluorophenyl)methanamine |
| InChIKey | KKTJLZPQCBGJQQ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)Br)F)F)CN |
Computed by PubChem (NCBI)