Products 1893048-01-5
CAS 1893048-01-5 is the registry number for 6-Methyl-1-(4-(trifluoromethyl)phenyl)-1,3-dihydro-2H-benzo[d]imidazol-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-methyl-3-[4-(trifluoromethyl)phenyl]-1H-benzimidazol-2-one (CAS 1893048-01-5) is a chemical compound with the molecular formula C15H11F3N2O and a molecular weight of 292.26 g/mol. IUPAC name: 5-methyl-3-[4-(trifluoromethyl)phenyl]-1H-benzimidazol-2-one. InChIKey: MFUFPBCBPLCSLO-UHFFFAOYSA-N.
| Molecular formula | C15H11F3N2O |
|---|---|
| Molecular weight | 292.26 g/mol |
| IUPAC name | 5-methyl-3-[4-(trifluoromethyl)phenyl]-1H-benzimidazol-2-one |
| InChIKey | MFUFPBCBPLCSLO-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)NC(=O)N2C3=CC=C(C=C3)C(F)(F)F |
Computed by PubChem (NCBI)