Products 18933-71-6
CAS 18933-71-6 appears in our catalog under these names: 2,3-Di-o-benzyl-d-glucopyranose, 98%, (3R,4S,5R,6R)-3,4-Bis(benzyloxy)-6-(hydroxymethyl)tetrahydro-2H-pyran-2,5-diol, 97%, 2,3-Di-O-benzyl-D-glucopyranose. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 25g, 100g, 5g, 1g, 50g, 500g, 250g.
(3R,4S,5R,6R)-6-(hydroxymethyl)-3,4-bis(phenylmethoxy)oxane-2,5-diol (CAS 18933-71-6) is a chemical compound with the molecular formula C20H24O6 and a molecular weight of 360.4 g/mol. IUPAC name: (3R,4S,5R,6R)-6-(hydroxymethyl)-3,4-bis(phenylmethoxy)oxane-2,5-diol. InChIKey: SEJPLCXOYKLKOZ-QUIYGKKVSA-N.
| Molecular formula | C20H24O6 |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | (3R,4S,5R,6R)-6-(hydroxymethyl)-3,4-bis(phenylmethoxy)oxane-2,5-diol |
| InChIKey | SEJPLCXOYKLKOZ-QUIYGKKVSA-N |
| SMILES | C1=CC=C(C=C1)CO[C@H]2[C@@H]([C@H](OC([C@@H]2OCC3=CC=CC=C3)O)CO)O |
Computed by PubChem (NCBI)