Products 189330-26-5

CAS 189330-26-5 is the registry number for 2-(Difluoromethyl)thiophene-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-(difluoromethyl)thiophene-3-carboxylic acid (CAS 189330-26-5) is a chemical compound with the molecular formula C6H4F2O2S and a molecular weight of 178.16 g/mol. IUPAC name: 2-(difluoromethyl)thiophene-3-carboxylic acid. InChIKey: BFMDXJOTIDRJCC-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4F2O2S
Molecular weight178.16 g/mol
IUPAC name2-(difluoromethyl)thiophene-3-carboxylic acid
InChIKeyBFMDXJOTIDRJCC-UHFFFAOYSA-N
SMILESC1=CSC(=C1C(=O)O)C(F)F

Computed by PubChem (NCBI)