CAS 1893991-79-1 is the registry number for tert-Butyl 2-formyl-5,6-dihydro-[1,2,4]triazolo[1,5-a]pyrazine-7(8H)-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2-formyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazine-7-carboxylate (CAS 1893991-79-1) is a chemical compound with the molecular formula C11H16N4O3 and a molecular weight of 252.27 g/mol. IUPAC name: tert-butyl 2-formyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazine-7-carboxylate. InChIKey: JUCTYKQQWVECCZ-UHFFFAOYSA-N.
| Molecular formula | C11H16N4O3 |
|---|---|
| Molecular weight | 252.27 g/mol |
| IUPAC name | tert-butyl 2-formyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazine-7-carboxylate |
| InChIKey | JUCTYKQQWVECCZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN2C(=NC(=N2)C=O)C1 |
Computed by PubChem (NCBI)