CAS 1894189-67-3 appears in our catalog under these names: (SP-4-2)-[4,4′-bis(1,1-dimethylethyl)-2,2′-bipyridine-κN1,κN1′]dibromo-Nickel 97%, (SP-4-2)-[4,4′-bis(1,1-dimethylethyl)-2,2′-bipyridine-κN1,κN1′]dibromo-Nickel, 98%, 98%, (Dtpby)NiBr2, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g, 10g, 250g.
4-tert-butyl-2-(4-tert-butyl-2-pyridinyl)pyridine;dibromonickel (CAS 1894189-67-3) is a chemical compound with the molecular formula C18H24Br2N2Ni and a molecular weight of 486.9 g/mol. IUPAC name: 4-tert-butyl-2-(4-tert-butyl-2-pyridinyl)pyridine;dibromonickel. InChIKey: NVZXIOAQCPNGDB-UHFFFAOYSA-L.
| Molecular formula | C18H24Br2N2Ni |
|---|---|
| Molecular weight | 486.9 g/mol |
| IUPAC name | 4-tert-butyl-2-(4-tert-butyl-2-pyridinyl)pyridine;dibromonickel |
| InChIKey | NVZXIOAQCPNGDB-UHFFFAOYSA-L |
| SMILES | CC(C)(C)C1=CC(=NC=C1)C2=NC=CC(=C2)C(C)(C)C.[Ni](Br)Br |
Computed by PubChem (NCBI)