CAS 18942-50-2 appears in our catalog under these names: Boc–Ser(tBu)–OH·DCHA, N-Boc-O-tert-butyl-L-serine dicyclohexylammonium salt, 98% , Boc-Ser(tBu)-OH·DCHA 98%, Boc-Ser(tBu)-OH.DCHA, 98%, 98%, BOC-SER(TBU)-OH DCHA, 95%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 1g.
N-cyclohexylcyclohexanamine;(2S)-3-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 18942-50-2) is a chemical compound with the molecular formula C24H46N2O5 and a molecular weight of 442.6 g/mol. IUPAC name: N-cyclohexylcyclohexanamine;(2S)-3-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: AIEUUHIXSUNTGV-QRPNPIFTSA-N.
| Molecular formula | C24H46N2O5 |
|---|---|
| Molecular weight | 442.6 g/mol |
| IUPAC name | N-cyclohexylcyclohexanamine;(2S)-3-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | AIEUUHIXSUNTGV-QRPNPIFTSA-N |
| SMILES | CC(C)(C)OC[C@@H](C(=O)O)NC(=O)OC(C)(C)C.C1CCC(CC1)NC2CCCCC2 |
Computed by PubChem (NCBI)