CAS 1894677-16-7 appears in our catalog under these names: Thiomorpholinoacetic Acid 1',1'-Dioxide Monohydrate, >98.0%(GC)(T), 2-(1,1-Dioxidothiomorpholino)acetic acid hydrate, 98.0%, 98.0%. Offered by: TCI, Chemat. Available pack sizes: 5g, 25g.
2-(1,1-dioxo-1,4-thiazinan-4-yl)acetic acid;hydrate (CAS 1894677-16-7) is a chemical compound with the molecular formula C6H13NO5S and a molecular weight of 211.24 g/mol. IUPAC name: 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetic acid;hydrate. InChIKey: KIPMGQHLUYMNMW-UHFFFAOYSA-N.
| Molecular formula | C6H13NO5S |
|---|---|
| Molecular weight | 211.24 g/mol |
| IUPAC name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetic acid;hydrate |
| InChIKey | KIPMGQHLUYMNMW-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCN1CC(=O)O.O |
Computed by PubChem (NCBI)