CAS 1894720-26-3 is the registry number for α,α,5-Trimethylbenzo[b]thiophene-2-methanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
2-(5-methyl-1-benzothiophen-2-yl)propan-2-ol (CAS 1894720-26-3) is a chemical compound with the molecular formula C12H14OS and a molecular weight of 206.31 g/mol. IUPAC name: 2-(5-methyl-1-benzothiophen-2-yl)propan-2-ol. InChIKey: FEWPBIZHNGBPMZ-UHFFFAOYSA-N.
| Molecular formula | C12H14OS |
|---|---|
| Molecular weight | 206.31 g/mol |
| IUPAC name | 2-(5-methyl-1-benzothiophen-2-yl)propan-2-ol |
| InChIKey | FEWPBIZHNGBPMZ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)SC(=C2)C(C)(C)O |
Computed by PubChem (NCBI)