CAS 1895027-47-0 appears in our catalog under these names: 5H-Pyrrolo(2,3-b)pyrazine-2-carboxylic acid, 97%, 5H-Pyrrolo[2,3-b]pyrazine-2-carboxylic acid, 97%, 97%, 5H-PYRROLO[2,3-B]PYRAZINE-2-CARBOXYLIC ACID, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 500mg.
5H-pyrrolo[2,3-b]pyrazine-2-carboxylic acid (CAS 1895027-47-0) is a chemical compound with the molecular formula C7H5N3O2 and a molecular weight of 163.13 g/mol. IUPAC name: 5H-pyrrolo[2,3-b]pyrazine-2-carboxylic acid. InChIKey: UOTXKOZTZRZXBZ-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 5H-pyrrolo[2,3-b]pyrazine-2-carboxylic acid |
| InChIKey | UOTXKOZTZRZXBZ-UHFFFAOYSA-N |
| SMILES | C1=CNC2=NC=C(N=C21)C(=O)O |
Computed by PubChem (NCBI)