CAS 189576-09-8 appears in our catalog under these names: 1,5-Dichloro-2-iodo-3-nitrobenzene, 95+%, 1,5-Dichloro-2-iodo-3-nitrobenzene. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
1,5-dichloro-2-iodo-3-nitrobenzene (CAS 189576-09-8) is a chemical compound with the molecular formula C6H2Cl2INO2 and a molecular weight of 317.89 g/mol. IUPAC name: 1,5-dichloro-2-iodo-3-nitrobenzene. InChIKey: XHJSVHPVRDHXFQ-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2INO2 |
|---|---|
| Molecular weight | 317.89 g/mol |
| IUPAC name | 1,5-dichloro-2-iodo-3-nitrobenzene |
| InChIKey | XHJSVHPVRDHXFQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])I)Cl)Cl |
Computed by PubChem (NCBI)