CAS 1895816-41-7 appears in our catalog under these names: 4-Bromo-n-(4-fluoro-2-trifluoromethyl-phenyl)-benzenesulfonamide, 95%, 4-Bromo-N-(4-fluoro-2-(trifluoromethyl)phenyl)-Benzenesulfonamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
4-bromo-N-[4-fluoro-2-(trifluoromethyl)phenyl]benzenesulfonamide (CAS 1895816-41-7) is a chemical compound with the molecular formula C13H8BrF4NO2S and a molecular weight of 398.17 g/mol. IUPAC name: 4-bromo-N-[4-fluoro-2-(trifluoromethyl)phenyl]benzenesulfonamide. InChIKey: YVUMGYBHZJIBRY-UHFFFAOYSA-N.
| Molecular formula | C13H8BrF4NO2S |
|---|---|
| Molecular weight | 398.17 g/mol |
| IUPAC name | 4-bromo-N-[4-fluoro-2-(trifluoromethyl)phenyl]benzenesulfonamide |
| InChIKey | YVUMGYBHZJIBRY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1S(=O)(=O)NC2=C(C=C(C=C2)F)C(F)(F)F)Br |
Computed by PubChem (NCBI)