CAS 1895865-08-3 appears in our catalog under these names: Enzalutamide Impurity 39, N-((4-Cyano-3-(trifluoromethyl)phenyl)carbamothioyl)benzamide 95%, N-((4-Cyano-3-(trifluoromethyl)phenyl)carbamothioyl)benzamide, 95%, 95%. Offered by: Chemat Brand, Ambeed, Chemat. Available pack sizes: on request, 250mg, 1g, 5g.
N-[[4-cyano-3-(trifluoromethyl)phenyl]carbamothioyl]benzamide (CAS 1895865-08-3) is a chemical compound with the molecular formula C16H10F3N3OS and a molecular weight of 349.3 g/mol. IUPAC name: N-[[4-cyano-3-(trifluoromethyl)phenyl]carbamothioyl]benzamide. InChIKey: QOUBZIALHCOXBN-UHFFFAOYSA-N.
| Molecular formula | C16H10F3N3OS |
|---|---|
| Molecular weight | 349.3 g/mol |
| IUPAC name | N-[[4-cyano-3-(trifluoromethyl)phenyl]carbamothioyl]benzamide |
| InChIKey | QOUBZIALHCOXBN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC(=S)NC2=CC(=C(C=C2)C#N)C(F)(F)F |
Computed by PubChem (NCBI)