CAS 1895922-70-9 appears in our catalog under these names: Fmoc-aminooxy-peg4-acid, 95%, Fmoc–aminooxy–PEG4–acid, Fmoc-aminooxy-PEG4-acid 98%, 1-(9H-Fluoren-9-ylmethyl) 3,6,9,12,15-pentaoxa-2-azaoctadecanedioate, 99%, 99%, Fmoc-aminooxy-PEG4-acid. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1g, 250mg, 100mg, 5g, 100 mg, 250 mg, 1 g.
3-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)oxyethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1895922-70-9) is a chemical compound with the molecular formula C26H33NO9 and a molecular weight of 503.5 g/mol. IUPAC name: 3-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)oxyethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: QJSNUHJABIFADD-UHFFFAOYSA-N.
| Molecular formula | C26H33NO9 |
|---|---|
| Molecular weight | 503.5 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)oxyethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | QJSNUHJABIFADD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)